C46H48MgN8O18P2 — CID 11636649
magnesium bis([3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl]methyl hydrogen phosphate) (PubChem CID 11636649) has the molecular formula C46H48MgN8O18P2 and a molecular weight of 1087.18 g/mol. Its IUPAC name is magnesium bis([3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl]methyl hydrogen phosphate).
| Compound Name | magnesium bis([3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl]methyl hydrogen phosphate) |
|---|---|
| PubChem CID | 11636649 |
| Molecular Formula | C46H48MgN8O18P2 |
| Molecular Weight | 1087.18 g/mol |
| Exact Mass | 1086.24 |
| IUPAC Name | magnesium bis([3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4,7-dimethoxypyrrolo[2,3-c]pyridin-1-yl]methyl hydrogen phosphate) |
| SMILES | COc1cnc(OC)c2c1c(C(=O)C(=O)N1CCN(C(=O)c3ccccc3)CC1)cn2COP(=O)([O-])O.COc1cnc(OC)c2c1c(C(=O)C(=O)N1CCN(C(=O)c3ccccc3)CC1)cn2COP(=O)([O-])O.[Mg+2] |
| InChI | InChI=1S/2C23H25N4O9P.Mg/c2*1-34-17-12-24-21(35-2)19-18(17)16(13-27(19)14-36-37(31,32)33)20(28)23(30)26-10-8-25(9-11-26)22(29)15-6-4-3-5-7-15;/h2*3-7,12-13H,8-11,14H2,1-2H3,(H2,31,32,33);/q;;+2/p-2 |
| InChIKey | DQRZHLZBZOFMGW-UHFFFAOYSA-L |
| XLogP | 0.93 |
| TPSA | 327.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|