C31H35FN7O8P — CID 88916024
(2S)-7-[[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-7-(triazol-1-yl)pyrrolo[2,3-c]pyridin-1-yl]methoxy-hydroxyphosphoryl]-2-methylheptanoic acid (PubChem CID 88916024) has the molecular formula C31H35FN7O8P and a molecular weight of 683.63 g/mol. Its IUPAC name is (2S)-7-[[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-7-(triazol-1-yl)pyrrolo[2,3-c]pyridin-1-yl]methoxy-hydroxyphosphoryl]-2-methylheptanoic acid.
| Compound Name | (2S)-7-[[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-7-(triazol-1-yl)pyrrolo[2,3-c]pyridin-1-yl]methoxy-hydroxyphosphoryl]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 88916024 |
| Molecular Formula | C31H35FN7O8P |
| Molecular Weight | 683.63 g/mol |
| Exact Mass | 683.23 |
| IUPAC Name | (2S)-7-[[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-7-(triazol-1-yl)pyrrolo[2,3-c]pyridin-1-yl]methoxy-hydroxyphosphoryl]-2-methylheptanoic acid |
| SMILES | C[C@@H](CCCCCP(=O)(O)OCn1cc(C(=O)C(=O)N2CCN(C(=O)c3ccccc3)CC2)c2c(F)cnc(-n3ccnn3)c21)C(=O)O |
| InChI | InChI=1S/C31H35FN7O8P/c1-21(31(43)44)8-4-3-7-17-48(45,46)47-20-38-19-23(25-24(32)18-33-28(26(25)38)39-12-11-34-35-39)27(40)30(42)37-15-13-36(14-16-37)29(41)22-9-5-2-6-10-22/h2,5-6,9-12,18-19,21H,3-4,7-8,13-17,20H2,1H3,(H,43,44)(H,45,46)/t21-/m0/s1 |
| InChIKey | ZHRWEFHTLXIWNY-NRFANRHFSA-N |
| XLogP | 3.36 |
| TPSA | 190.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|