C23H21FN6O2 — CID 73292586
1-(4-benzylpiperidin-1-yl)-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 73292586) has the molecular formula C23H21FN6O2 and a molecular weight of 432.46 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 73292586 |
| Molecular Formula | C23H21FN6O2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC(Cc2ccccc2)CC1)c1c[nH]c2c(-n3ccnn3)ncc(F)c12 |
| InChI | InChI=1S/C23H21FN6O2/c24-18-14-26-22(30-11-8-27-28-30)20-19(18)17(13-25-20)21(31)23(32)29-9-6-16(7-10-29)12-15-4-2-1-3-5-15/h1-5,8,11,13-14,16,25H,6-7,9-10,12H2 |
| InChIKey | SOMPOHRCCVYWDO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|