C22H19FN6O3 — CID 86295938
1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-phenoxypiperidin-1-yl)ethane-1,2-dione (PubChem CID 86295938) has the molecular formula C22H19FN6O3 and a molecular weight of 434.43 g/mol. Its IUPAC name is 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-phenoxypiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-phenoxypiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 86295938 |
| Molecular Formula | C22H19FN6O3 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-phenoxypiperidin-1-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC(Oc2ccccc2)CC1)c1c[nH]c2c(-n3ccnn3)ncc(F)c12 |
| InChI | InChI=1S/C22H19FN6O3/c23-17-13-25-21(29-11-8-26-27-29)19-18(17)16(12-24-19)20(30)22(31)28-9-6-15(7-10-28)32-14-4-2-1-3-5-14/h1-5,8,11-13,15,24H,6-7,9-10H2 |
| InChIKey | XLYFWRIEKGTHNU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|