C28H34FN7O4 — CID 67963439
1-[4-[(3S,5R)-3-ethyl-5-hydroxy-3,6-dimethylbicyclo[3.2.1]octane-6-carbonyl]piperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 67963439) has the molecular formula C28H34FN7O4 and a molecular weight of 551.62 g/mol. Its IUPAC name is 1-[4-[(3S,5R)-3-ethyl-5-hydroxy-3,6-dimethylbicyclo[3.2.1]octane-6-carbonyl]piperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[4-[(3S,5R)-3-ethyl-5-hydroxy-3,6-dimethylbicyclo[3.2.1]octane-6-carbonyl]piperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 67963439 |
| Molecular Formula | C28H34FN7O4 |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 1-[4-[(3S,5R)-3-ethyl-5-hydroxy-3,6-dimethylbicyclo[3.2.1]octane-6-carbonyl]piperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | CC[C@@]1(C)CC2CC(C)(C(=O)N3CCN(C(=O)C(=O)c4c[nH]c5c(-n6ccnn6)ncc(F)c45)CC3)[C@@](O)(C2)C1 |
| InChI | InChI=1S/C28H34FN7O4/c1-4-26(2)11-17-12-27(3,28(40,13-17)16-26)25(39)35-9-7-34(8-10-35)24(38)22(37)18-14-30-21-20(18)19(29)15-31-23(21)36-6-5-32-33-36/h5-6,14-15,17,30,40H,4,7-13,16H2,1-3H3/t17?,26-,27?,28+/m0/s1 |
| InChIKey | OXFJSMWMDDIILO-DUPNWKJUSA-N |
| XLogP | 2.49 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|