C17H18N6O3 — CID 157125285
1-[4-methoxy-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-piperidin-1-ylethane-1,2-dione (PubChem CID 157125285) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-[4-methoxy-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-piperidin-1-ylethane-1,2-dione.
| Compound Name | 1-[4-methoxy-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-piperidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 157125285 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-[4-methoxy-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-piperidin-1-ylethane-1,2-dione |
| SMILES | COc1cnc(-n2ccnn2)c2[nH]cc(C(=O)C(=O)N3CCCCC3)c12 |
| InChI | InChI=1S/C17H18N6O3/c1-26-12-10-19-16(23-8-5-20-21-23)14-13(12)11(9-18-14)15(24)17(25)22-6-3-2-4-7-22/h5,8-10,18H,2-4,6-7H2,1H3 |
| InChIKey | AIKYXRMNUXMQFR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|