C23H25FN6O2 — CID 134318961
1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(3-benzylpiperidin-1-yl)ethane-1,2-dione (PubChem CID 134318961) has the molecular formula C23H25FN6O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(3-benzylpiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(3-benzylpiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 134318961 |
| Molecular Formula | C23H25FN6O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(3-benzylpiperidin-1-yl)ethane-1,2-dione |
| SMILES | N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCCC(Cc4ccccc4)C3)c[nH]c12 |
| InChI | InChI=1S/C23H25FN6O2/c24-18-13-28-22(30(26)10-8-25)20-19(18)17(12-27-20)21(31)23(32)29-9-4-7-16(14-29)11-15-5-2-1-3-6-15/h1-3,5-6,8,10,12-13,16,27H,4,7,9,11,14,25-26H2/b10-8- |
| InChIKey | DLHAVSHFSVGTEQ-NTMALXAHSA-N |
| XLogP | 2.48 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|