C26H26FN11O2 — CID 71290654
1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[7-(1-phenyltetrazol-5-yl)-2,7-diazaspiro[4.4]nonan-2-yl]ethane-1,2-dione (PubChem CID 71290654) has the molecular formula C26H26FN11O2 and a molecular weight of 543.57 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[7-(1-phenyltetrazol-5-yl)-2,7-diazaspiro[4.4]nonan-2-yl]ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[7-(1-phenyltetrazol-5-yl)-2,7-diazaspiro[4.4]nonan-2-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 71290654 |
| Molecular Formula | C26H26FN11O2 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[7-(1-phenyltetrazol-5-yl)-2,7-diazaspiro[4.4]nonan-2-yl]ethane-1,2-dione |
| SMILES | C=N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCC4(CCN(c5nnnn5-c5ccccc5)C4)C3)c[nH]c12 |
| InChI | InChI=1S/C26H26FN11O2/c1-29-9-12-37(28)23-21-20(19(27)14-31-23)18(13-30-21)22(39)24(40)35-10-7-26(15-35)8-11-36(16-26)25-32-33-34-38(25)17-5-3-2-4-6-17/h2-6,9,12-14,30H,1,7-8,10-11,15-16,28H2/b12-9- |
| InChIKey | NPLIFWOUFKNELM-XFXZXTDPSA-N |
| XLogP | 1.84 |
| TPSA | 154.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|