C21H22FN7O2 — CID 134318966
1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(3-anilinopyrrolidin-1-yl)ethane-1,2-dione (PubChem CID 134318966) has the molecular formula C21H22FN7O2 and a molecular weight of 423.45 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(3-anilinopyrrolidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(3-anilinopyrrolidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 134318966 |
| Molecular Formula | C21H22FN7O2 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(3-anilinopyrrolidin-1-yl)ethane-1,2-dione |
| SMILES | N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCC(Nc4ccccc4)C3)c[nH]c12 |
| InChI | InChI=1S/C21H22FN7O2/c22-16-11-26-20(29(24)9-7-23)18-17(16)15(10-25-18)19(30)21(31)28-8-6-14(12-28)27-13-4-2-1-3-5-13/h1-5,7,9-11,14,25,27H,6,8,12,23-24H2/b9-7- |
| InChIKey | BZPZNQTXZBBTNO-CLFYSBASSA-N |
| XLogP | 1.71 |
| TPSA | 133.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|