C23H25FN8O2 — CID 143436553
1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(N-methyl-C-phenylcarbonimidoyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 143436553) has the molecular formula C23H25FN8O2 and a molecular weight of 464.51 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(N-methyl-C-phenylcarbonimidoyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(N-methyl-C-phenylcarbonimidoyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 143436553 |
| Molecular Formula | C23H25FN8O2 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(N-methyl-C-phenylcarbonimidoyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | C/N=C(\c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3c(N(N)/C=C\N)ncc(F)c23)CC1 |
| InChI | InChI=1S/C23H25FN8O2/c1-27-21(15-5-3-2-4-6-15)30-9-11-31(12-10-30)23(34)20(33)16-13-28-19-18(16)17(24)14-29-22(19)32(26)8-7-25/h2-8,13-14,28H,9-12,25-26H2,1H3/b8-7-,27-21+ |
| InChIKey | RUHNLSIJCLSVOF-GSNJNLRFSA-N |
| XLogP | 1.22 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|