C22H19F2N5O3 — CID 58852096
(E)-[[4-[2-(4,7-difluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]urea (PubChem CID 58852096) has the molecular formula C22H19F2N5O3 and a molecular weight of 439.42 g/mol. Its IUPAC name is (E)-[[4-[2-(4,7-difluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]urea.
| Compound Name | (E)-[[4-[2-(4,7-difluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]urea |
|---|---|
| PubChem CID | 58852096 |
| Molecular Formula | C22H19F2N5O3 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (E)-[[4-[2-(4,7-difluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]urea |
| SMILES | NC(=O)/N=C(\c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3c(F)ccc(F)c23)CC1 |
| InChI | InChI=1S/C22H19F2N5O3/c23-15-6-7-16(24)18-17(15)14(12-26-18)19(30)21(31)29-10-8-28(9-11-29)20(27-22(25)32)13-4-2-1-3-5-13/h1-7,12,26H,8-11H2,(H2,25,32)/b27-20+ |
| InChIKey | NKYPEIGXHFNGPP-NHFJDJAPSA-N |
| XLogP | 2.30 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|