C22H17BrFN5O2 — CID 16729445
[[4-[2-(7-bromo-4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]cyanamide (PubChem CID 16729445) has the molecular formula C22H17BrFN5O2 and a molecular weight of 482.31 g/mol. Its IUPAC name is [[4-[2-(7-bromo-4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]cyanamide.
| Compound Name | [[4-[2-(7-bromo-4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]cyanamide |
|---|---|
| PubChem CID | 16729445 |
| Molecular Formula | C22H17BrFN5O2 |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | [[4-[2-(7-bromo-4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]cyanamide |
| SMILES | N#C/N=C(\c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3c(Br)ccc(F)c23)CC1 |
| InChI | InChI=1S/C22H17BrFN5O2/c23-16-6-7-17(24)18-15(12-26-19(16)18)20(30)22(31)29-10-8-28(9-11-29)21(27-13-25)14-4-2-1-3-5-14/h1-7,12,26H,8-11H2/b27-21+ |
| InChIKey | QDGBJQRYGFKFOW-SZXQPVLSSA-N |
| XLogP | 3.32 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|