C23H21FN4O4 — CID 71075816
methyl N-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]carbamate (PubChem CID 71075816) has the molecular formula C23H21FN4O4 and a molecular weight of 436.44 g/mol. Its IUPAC name is methyl N-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]carbamate.
| Compound Name | methyl N-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]carbamate |
|---|---|
| PubChem CID | 71075816 |
| Molecular Formula | C23H21FN4O4 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | methyl N-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]carbamate |
| SMILES | COC(=O)N=C(c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3cccc(F)c23)CC1 |
| InChI | InChI=1S/C23H21FN4O4/c1-32-23(31)26-21(15-6-3-2-4-7-15)27-10-12-28(13-11-27)22(30)20(29)16-14-25-18-9-5-8-17(24)19(16)18/h2-9,14,25H,10-13H2,1H3 |
| InChIKey | MRRYIPIXOMZAAR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|