C23H20FN5O2 — CID 88884608
[[4-[2-(4-fluoro-7-methyl-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]cyanamide (PubChem CID 88884608) has the molecular formula C23H20FN5O2 and a molecular weight of 417.44 g/mol. Its IUPAC name is [[4-[2-(4-fluoro-7-methyl-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]cyanamide.
| Compound Name | [[4-[2-(4-fluoro-7-methyl-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]cyanamide |
|---|---|
| PubChem CID | 88884608 |
| Molecular Formula | C23H20FN5O2 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [[4-[2-(4-fluoro-7-methyl-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]cyanamide |
| SMILES | Cc1ccc(F)c2c(C(=O)C(=O)N3CCN(/C(=N/C#N)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C23H20FN5O2/c1-15-7-8-18(24)19-17(13-26-20(15)19)21(30)23(31)29-11-9-28(10-12-29)22(27-14-25)16-5-3-2-4-6-16/h2-8,13,26H,9-12H2,1H3/b27-22+ |
| InChIKey | MYQQNVUEWBELBE-HPNDGRJYSA-N |
| XLogP | 2.87 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|