C21H16FN5O3 — CID 59058875
4-fluoro-3-[2-oxo-2-[4-(pyridine-2-carbonyl)piperazin-1-yl]acetyl]-1H-indole-7-carbonitrile (PubChem CID 59058875) has the molecular formula C21H16FN5O3 and a molecular weight of 405.39 g/mol. Its IUPAC name is 4-fluoro-3-[2-oxo-2-[4-(pyridine-2-carbonyl)piperazin-1-yl]acetyl]-1H-indole-7-carbonitrile.
| Compound Name | 4-fluoro-3-[2-oxo-2-[4-(pyridine-2-carbonyl)piperazin-1-yl]acetyl]-1H-indole-7-carbonitrile |
|---|---|
| PubChem CID | 59058875 |
| Molecular Formula | C21H16FN5O3 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 4-fluoro-3-[2-oxo-2-[4-(pyridine-2-carbonyl)piperazin-1-yl]acetyl]-1H-indole-7-carbonitrile |
| SMILES | N#Cc1ccc(F)c2c(C(=O)C(=O)N3CCN(C(=O)c4ccccn4)CC3)c[nH]c12 |
| InChI | InChI=1S/C21H16FN5O3/c22-15-5-4-13(11-23)18-17(15)14(12-25-18)19(28)21(30)27-9-7-26(8-10-27)20(29)16-3-1-2-6-24-16/h1-6,12,25H,7-10H2 |
| InChIKey | RCLXNZSQTVZUNA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|