C26H21FN4O3 — CID 507824
1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-pyridin-3-yl-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 507824) has the molecular formula C26H21FN4O3 and a molecular weight of 456.48 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-pyridin-3-yl-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-pyridin-3-yl-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 507824 |
| Molecular Formula | C26H21FN4O3 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-pyridin-3-yl-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1c[nH]c2c(-c3cccnc3)ccc(F)c12 |
| InChI | InChI=1S/C26H21FN4O3/c27-21-9-8-19(18-7-4-10-28-15-18)23-22(21)20(16-29-23)24(32)26(34)31-13-11-30(12-14-31)25(33)17-5-2-1-3-6-17/h1-10,15-16,29H,11-14H2 |
| InChIKey | STBDUTWCMAYQBO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|