C25H22FN7O3 — CID 507831
1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(2-prop-2-enyltetrazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione (PubChem CID 507831) has the molecular formula C25H22FN7O3 and a molecular weight of 487.50 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(2-prop-2-enyltetrazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(2-prop-2-enyltetrazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 507831 |
| Molecular Formula | C25H22FN7O3 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(2-prop-2-enyltetrazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione |
| SMILES | C=CCn1nnc(-c2ccc(F)c3c(C(=O)C(=O)N4CCN(C(=O)c5ccccc5)CC4)c[nH]c23)n1 |
| InChI | InChI=1S/C25H22FN7O3/c1-2-10-33-29-23(28-30-33)17-8-9-19(26)20-18(15-27-21(17)20)22(34)25(36)32-13-11-31(12-14-32)24(35)16-6-4-3-5-7-16/h2-9,15,27H,1,10-14H2 |
| InChIKey | MZXPRZGDIAQNBZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|