C25H28FN7O3 — CID 142107599
N'-[amino(ethyl)amino]-2-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-1H-indol-7-yl]ethanimidamide (PubChem CID 142107599) has the molecular formula C25H28FN7O3 and a molecular weight of 493.54 g/mol. Its IUPAC name is N'-[amino(ethyl)amino]-2-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-1H-indol-7-yl]ethanimidamide.
| Compound Name | N'-[amino(ethyl)amino]-2-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-1H-indol-7-yl]ethanimidamide |
|---|---|
| PubChem CID | 142107599 |
| Molecular Formula | C25H28FN7O3 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N'-[amino(ethyl)amino]-2-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-fluoro-1H-indol-7-yl]ethanimidamide |
| SMILES | CCN(N)/N=C(\N)Cc1ccc(F)c2c(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C25H28FN7O3/c1-2-33(28)30-20(27)14-17-8-9-19(26)21-18(15-29-22(17)21)23(34)25(36)32-12-10-31(11-13-32)24(35)16-6-4-3-5-7-16/h3-9,15,29H,2,10-14,28H2,1H3,(H2,27,30) |
| InChIKey | AMYSVAMUBKUZSJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|