C29H36FN5O5 — CID 142107713
1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-methyl-1H-indol-3-yl)ethane-1,2-dione;N-ethylformamide;morpholine (PubChem CID 142107713) has the molecular formula C29H36FN5O5 and a molecular weight of 553.64 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-methyl-1H-indol-3-yl)ethane-1,2-dione;N-ethylformamide;morpholine.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-methyl-1H-indol-3-yl)ethane-1,2-dione;N-ethylformamide;morpholine |
|---|---|
| PubChem CID | 142107713 |
| Molecular Formula | C29H36FN5O5 |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-methyl-1H-indol-3-yl)ethane-1,2-dione;N-ethylformamide;morpholine |
| SMILES | C1COCCN1.CCNC=O.Cc1ccc(F)c2c(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C22H20FN3O3.C4H9NO.C3H7NO/c1-14-7-8-17(23)18-16(13-24-19(14)18)20(27)22(29)26-11-9-25(10-12-26)21(28)15-5-3-2-4-6-15;1-3-6-4-2-5-1;1-2-4-3-5/h2-8,13,24H,9-12H2,1H3;5H,1-4H2;3H,2H2,1H3,(H,4,5) |
| InChIKey | PIBCVGBNSKJMRE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|