C24H22FN7O3 — CID 59058926
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[4-fluoro-7-(2-methyltetrazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione (PubChem CID 59058926) has the molecular formula C24H22FN7O3 and a molecular weight of 475.48 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[4-fluoro-7-(2-methyltetrazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[4-fluoro-7-(2-methyltetrazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 59058926 |
| Molecular Formula | C24H22FN7O3 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[4-fluoro-7-(2-methyltetrazol-5-yl)-1H-indol-3-yl]ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(-c3nnn(C)n3)ccc(F)c12 |
| InChI | InChI=1S/C24H22FN7O3/c1-14-13-31(23(34)15-6-4-3-5-7-15)10-11-32(14)24(35)21(33)17-12-26-20-16(8-9-18(25)19(17)20)22-27-29-30(2)28-22/h3-9,12,14,26H,10-11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | VYVPQDHYURYRPY-CQSZACIVSA-N |
| XLogP | 2.05 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|