C23H23FN4O4 — CID 506275
1-[(2R)-4-(3-aminobenzoyl)-2-methylpiperazin-1-yl]-2-(4-fluoro-7-methoxy-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 506275) has the molecular formula C23H23FN4O4 and a molecular weight of 438.46 g/mol. Its IUPAC name is 1-[(2R)-4-(3-aminobenzoyl)-2-methylpiperazin-1-yl]-2-(4-fluoro-7-methoxy-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-(3-aminobenzoyl)-2-methylpiperazin-1-yl]-2-(4-fluoro-7-methoxy-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 506275 |
| Molecular Formula | C23H23FN4O4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-[(2R)-4-(3-aminobenzoyl)-2-methylpiperazin-1-yl]-2-(4-fluoro-7-methoxy-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | COc1ccc(F)c2c(C(=O)C(=O)N3CCN(C(=O)c4cccc(N)c4)C[C@H]3C)c[nH]c12 |
| InChI | InChI=1S/C23H23FN4O4/c1-13-12-27(22(30)14-4-3-5-15(25)10-14)8-9-28(13)23(31)21(29)16-11-26-20-18(32-2)7-6-17(24)19(16)20/h3-7,10-11,13,26H,8-9,12,25H2,1-2H3/t13-/m1/s1 |
| InChIKey | KNEXYPXXGYROTM-CYBMUJFWSA-N |
| XLogP | 2.45 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|