C24H23N3O4 — CID 5280294
1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(5-methoxyquinolin-2-yl)ethane-1,2-dione (PubChem CID 5280294) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(5-methoxyquinolin-2-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(5-methoxyquinolin-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 5280294 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-(4-benzoyl-2-methylpiperazin-1-yl)-2-(5-methoxyquinolin-2-yl)ethane-1,2-dione |
| SMILES | COc1cccc2nc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3C)ccc12 |
| InChI | InChI=1S/C24H23N3O4/c1-16-15-26(23(29)17-7-4-3-5-8-17)13-14-27(16)24(30)22(28)20-12-11-18-19(25-20)9-6-10-21(18)31-2/h3-12,16H,13-15H2,1-2H3 |
| InChIKey | UBUUUZBAHWIPGZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|