C21H18FN7O4 — CID 507842
1-[4-fluoro-7-(2-methyltetrazol-5-yl)-1H-indol-3-yl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 507842) has the molecular formula C21H18FN7O4 and a molecular weight of 451.42 g/mol. Its IUPAC name is 1-[4-fluoro-7-(2-methyltetrazol-5-yl)-1H-indol-3-yl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-fluoro-7-(2-methyltetrazol-5-yl)-1H-indol-3-yl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 507842 |
| Molecular Formula | C21H18FN7O4 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-[4-fluoro-7-(2-methyltetrazol-5-yl)-1H-indol-3-yl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | Cn1nnc(-c2ccc(F)c3c(C(=O)C(=O)N4CCN(C(=O)c5ccco5)CC4)c[nH]c23)n1 |
| InChI | InChI=1S/C21H18FN7O4/c1-27-25-19(24-26-27)12-4-5-14(22)16-13(11-23-17(12)16)18(30)21(32)29-8-6-28(7-9-29)20(31)15-3-2-10-33-15/h2-5,10-11,23H,6-9H2,1H3 |
| InChIKey | RLCYLTRNGLSNCB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|