C21H18BrFN4O2 — CID 16729478
1-[4-(benzenecarboximidoyl)piperazin-1-yl]-2-(7-bromo-4-fluoro-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 16729478) has the molecular formula C21H18BrFN4O2 and a molecular weight of 457.30 g/mol. Its IUPAC name is 1-[4-(benzenecarboximidoyl)piperazin-1-yl]-2-(7-bromo-4-fluoro-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[4-(benzenecarboximidoyl)piperazin-1-yl]-2-(7-bromo-4-fluoro-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 16729478 |
| Molecular Formula | C21H18BrFN4O2 |
| Molecular Weight | 457.30 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 1-[4-(benzenecarboximidoyl)piperazin-1-yl]-2-(7-bromo-4-fluoro-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | [H]/N=C(\c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3c(Br)ccc(F)c23)CC1 |
| InChI | InChI=1S/C21H18BrFN4O2/c22-15-6-7-16(23)17-14(12-25-18(15)17)19(28)21(29)27-10-8-26(9-11-27)20(24)13-4-2-1-3-5-13/h1-7,12,24-25H,8-11H2/b24-20+ |
| InChIKey | SLJYTVXDXASOEY-HIXSDJFHSA-N |
| XLogP | 3.42 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|