C22H20FN5O3 — CID 58852039
(E)-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]urea (PubChem CID 58852039) has the molecular formula C22H20FN5O3 and a molecular weight of 421.43 g/mol. Its IUPAC name is (E)-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]urea.
| Compound Name | (E)-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]urea |
|---|---|
| PubChem CID | 58852039 |
| Molecular Formula | C22H20FN5O3 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (E)-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]urea |
| SMILES | NC(=O)/N=C(\c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3cccc(F)c23)CC1 |
| InChI | InChI=1S/C22H20FN5O3/c23-16-7-4-8-17-18(16)15(13-25-17)19(29)21(30)28-11-9-27(10-12-28)20(26-22(24)31)14-5-2-1-3-6-14/h1-8,13,25H,9-12H2,(H2,24,31)/b26-20+ |
| InChIKey | KRIIMNSKEZHYEN-LHLOQNFPSA-N |
| XLogP | 2.16 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|