C22H21FN4O4S — CID 16729440
(NE)-N-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]methanesulfonamide (PubChem CID 16729440) has the molecular formula C22H21FN4O4S and a molecular weight of 456.50 g/mol. Its IUPAC name is (NE)-N-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]methanesulfonamide.
| Compound Name | (NE)-N-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]methanesulfonamide |
|---|---|
| PubChem CID | 16729440 |
| Molecular Formula | C22H21FN4O4S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | (NE)-N-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]methanesulfonamide |
| SMILES | CS(=O)(=O)/N=C(\c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3cccc(F)c23)CC1 |
| InChI | InChI=1S/C22H21FN4O4S/c1-32(30,31)25-21(15-6-3-2-4-7-15)26-10-12-27(13-11-26)22(29)20(28)16-14-24-18-9-5-8-17(23)19(16)18/h2-9,14,24H,10-13H2,1H3/b25-21+ |
| InChIKey | XRFUXCYEXDFWCO-NJNXFGOHSA-N |
| XLogP | 2.04 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|