C24H24FN5O3 — CID 71075836
3-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]-1,1-dimethylurea (PubChem CID 71075836) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is 3-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]-1,1-dimethylurea.
| Compound Name | 3-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]-1,1-dimethylurea |
|---|---|
| PubChem CID | 71075836 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 3-[[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-phenylmethylidene]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N=C(c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3cccc(F)c23)CC1 |
| InChI | InChI=1S/C24H24FN5O3/c1-28(2)24(33)27-22(16-7-4-3-5-8-16)29-11-13-30(14-12-29)23(32)21(31)17-15-26-19-10-6-9-18(25)20(17)19/h3-10,15,26H,11-14H2,1-2H3 |
| InChIKey | DGBLEVFHSPFQEU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|