About (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea
(3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea (PubChem CID 58852088) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea.
Molecular Properties
| Compound Name | (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea |
| PubChem CID | 58852088 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea |
| SMILES | CN(C)C(=O)/N=C(\c1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C14H20N4O/c1-17(2)14(19)16-13(12-6-4-3-5-7-12)18-10-8-15-9-11-18/h3-7,15H,8-11H2,1-2H3/b16-13+ |
| InChIKey | SEKOOKSZJKZEOF-DTQAZKPQSA-N |
| XLogP | 1.02 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea?
The IUPAC name of (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea (CID 58852088) is (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea.
What is the SMILES notation for (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea?
The canonical SMILES for (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea is CN(C)C(=O)/N=C(\c1ccccc1)N1CCNCC1.
What is the InChIKey of (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea?
The InChIKey is SEKOOKSZJKZEOF-DTQAZKPQSA-N. The full InChI is InChI=1S/C14H20N4O/c1-17(2)14(19)16-13(12-6-4-3-5-7-12)18-10-8-15-9-11-18/h3-7,15H,8-11H2,1-2H3/b16-13+.
What are the key properties of (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea?
(3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea has a molecular weight of 260.34 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1,1-dimethyl-3-[phenyl(piperazin-1-yl)methylidene]urea is sourced from PubChem (CID 58852088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).