C24H18FN3O4 — CID 16755728
3-[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-4-phenylcyclobut-3-ene-1,2-dione (PubChem CID 16755728) has the molecular formula C24H18FN3O4 and a molecular weight of 431.42 g/mol. Its IUPAC name is 3-[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-4-phenylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-4-phenylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 16755728 |
| Molecular Formula | C24H18FN3O4 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-[4-[2-(4-fluoro-1H-indol-3-yl)-2-oxoacetyl]piperazin-1-yl]-4-phenylcyclobut-3-ene-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(c2c(-c3ccccc3)c(=O)c2=O)CC1)c1c[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C24H18FN3O4/c25-16-7-4-8-17-19(16)15(13-26-17)21(29)24(32)28-11-9-27(10-12-28)20-18(22(30)23(20)31)14-5-2-1-3-6-14/h1-8,13,26H,9-12H2 |
| InChIKey | AHEVLLJQZQFWEW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|