C19H16FN3O4 — CID 113208080
1-(5-fluoro-1H-indol-3-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 113208080) has the molecular formula C19H16FN3O4 and a molecular weight of 369.35 g/mol. Its IUPAC name is 1-(5-fluoro-1H-indol-3-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(5-fluoro-1H-indol-3-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 113208080 |
| Molecular Formula | C19H16FN3O4 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-(5-fluoro-1H-indol-3-yl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccco2)CC1)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C19H16FN3O4/c20-12-3-4-15-13(10-12)14(11-21-15)17(24)19(26)23-7-5-22(6-8-23)18(25)16-2-1-9-27-16/h1-4,9-11,21H,5-8H2 |
| InChIKey | VORAEAGNGNTNDV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|