C19H19N3O3 — CID 945225
2-[4-(furan-2-carbonyl)piperazin-1-yl]-1-(1H-indol-3-yl)ethanone (PubChem CID 945225) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazin-1-yl]-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 945225 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-1-(1H-indol-3-yl)ethanone |
| SMILES | O=C(CN1CCN(C(=O)c2ccco2)CC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H19N3O3/c23-17(15-12-20-16-5-2-1-4-14(15)16)13-21-7-9-22(10-8-21)19(24)18-6-3-11-25-18/h1-6,11-12,20H,7-10,13H2 |
| InChIKey | IBPHVNFOTUPOPO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |