C22H21Cl2N3O3 — CID 110659763
2-[4-(3,6-dichloro-2-methoxybenzoyl)piperazin-1-yl]-1-(1H-indol-3-yl)ethanone (PubChem CID 110659763) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is 2-[4-(3,6-dichloro-2-methoxybenzoyl)piperazin-1-yl]-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-[4-(3,6-dichloro-2-methoxybenzoyl)piperazin-1-yl]-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 110659763 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-[4-(3,6-dichloro-2-methoxybenzoyl)piperazin-1-yl]-1-(1H-indol-3-yl)ethanone |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)N1CCN(CC(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H21Cl2N3O3/c1-30-21-17(24)7-6-16(23)20(21)22(29)27-10-8-26(9-11-27)13-19(28)15-12-25-18-5-3-2-4-14(15)18/h2-7,12,25H,8-11,13H2,1H3 |
| InChIKey | HIMRSWASWSGWMM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |