C15H19N3O3S — CID 31872453
1-(1H-indol-3-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 31872453) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 1-(1H-indol-3-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 31872453 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CS(=O)(=O)N1CCN(CC(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C15H19N3O3S/c1-22(20,21)18-8-6-17(7-9-18)11-15(19)13-10-16-14-5-3-2-4-12(13)14/h2-5,10,16H,6-9,11H2,1H3 |
| InChIKey | CAHDGAUNGPQELN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |