C20H23N3O3S2 — CID 110659791
2-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-1-(1H-indol-3-yl)ethanone (PubChem CID 110659791) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 110659791 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-1-(1H-indol-3-yl)ethanone |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(CC(=O)c3c[nH]c4ccccc34)CC2)s1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-2-15-7-8-20(27-15)28(25,26)23-11-9-22(10-12-23)14-19(24)17-13-21-18-6-4-3-5-16(17)18/h3-8,13,21H,2,9-12,14H2,1H3 |
| InChIKey | OKYVUHYRXJNTAK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |