C23H24ClN3O3 — CID 55829396
methyl 2-(2-chlorophenyl)-2-[4-[2-(1H-indol-3-yl)-2-oxoethyl]piperazin-1-yl]acetate (PubChem CID 55829396) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-[4-[2-(1H-indol-3-yl)-2-oxoethyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-(2-chlorophenyl)-2-[4-[2-(1H-indol-3-yl)-2-oxoethyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 55829396 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-[4-[2-(1H-indol-3-yl)-2-oxoethyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCN(CC(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-30-23(29)22(17-7-2-4-8-19(17)24)27-12-10-26(11-13-27)15-21(28)18-14-25-20-9-5-3-6-16(18)20/h2-9,14,22,25H,10-13,15H2,1H3 |
| InChIKey | WCXGDWJNZMRQJX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |