C21H30ClN3O5 — CID 42944113
ethyl 4-[[2-[4-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperazin-1-yl]acetyl]amino]butanoate (PubChem CID 42944113) has the molecular formula C21H30ClN3O5 and a molecular weight of 439.94 g/mol. Its IUPAC name is ethyl 4-[[2-[4-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperazin-1-yl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[4-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperazin-1-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 42944113 |
| Molecular Formula | C21H30ClN3O5 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | ethyl 4-[[2-[4-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperazin-1-yl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CN1CCN(C(C(=O)OC)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H30ClN3O5/c1-3-30-19(27)9-6-10-23-18(26)15-24-11-13-25(14-12-24)20(21(28)29-2)16-7-4-5-8-17(16)22/h4-5,7-8,20H,3,6,9-15H2,1-2H3,(H,23,26) |
| InChIKey | BDPLZDJWFJIYLL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|