C24H30ClN3O4 — CID 43049776
methyl 2-(2-chlorophenyl)-2-[4-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]piperazin-1-yl]acetate (PubChem CID 43049776) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-[4-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-(2-chlorophenyl)-2-[4-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 43049776 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-[4-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCN(CC(=O)NCCOc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C24H30ClN3O4/c1-18-6-5-7-19(16-18)32-15-10-26-22(29)17-27-11-13-28(14-12-27)23(24(30)31-2)20-8-3-4-9-21(20)25/h3-9,16,23H,10-15,17H2,1-2H3,(H,26,29) |
| InChIKey | VTYMXHGTTALTAS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|