C16H15N3O3 — CID 42581260
N-[2-(furan-2-carbonylamino)ethyl]-1H-indole-3-carboxamide (PubChem CID 42581260) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[2-(furan-2-carbonylamino)ethyl]-1H-indole-3-carboxamide.
| Compound Name | N-[2-(furan-2-carbonylamino)ethyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 42581260 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-(furan-2-carbonylamino)ethyl]-1H-indole-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1c[nH]c2ccccc12)c1ccco1 |
| InChI | InChI=1S/C16H15N3O3/c20-15(12-10-19-13-5-2-1-4-11(12)13)17-7-8-18-16(21)14-6-3-9-22-14/h1-6,9-10,19H,7-8H2,(H,17,20)(H,18,21) |
| InChIKey | GTRVPQZPARVCGW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|