C17H14N2O5 — CID 7899244
[2-(1H-indol-3-yl)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate (PubChem CID 7899244) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7899244 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1ccco1)OCC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H14N2O5/c20-14(12-8-18-13-5-2-1-4-11(12)13)10-24-16(21)9-19-17(22)15-6-3-7-23-15/h1-8,18H,9-10H2,(H,19,22) |
| InChIKey | FRVDMPUPYRNCSX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |