C16H14N2O6 — CID 7879888
(2-benzamido-2-oxoethyl) 2-(furan-2-carbonylamino)acetate (PubChem CID 7879888) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-(furan-2-carbonylamino)acetate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7879888 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-(furan-2-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O6/c19-13(18-15(21)11-5-2-1-3-6-11)10-24-14(20)9-17-16(22)12-7-4-8-23-12/h1-8H,9-10H2,(H,17,22)(H,18,19,21) |
| InChIKey | GHTRHDLIGTYUSW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |