C18H19N3O7 — CID 7884691
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate (PubChem CID 7884691) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7884691 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccc(C(=O)NCC(=O)OCC(=O)NNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H19N3O7/c1-2-26-13-7-5-12(6-8-13)17(24)19-10-16(23)28-11-15(22)20-21-18(25)14-4-3-9-27-14/h3-9H,2,10-11H2,1H3,(H,19,24)(H,20,22)(H,21,25) |
| InChIKey | VYUXNBZLCQJFNV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|