C15H20N2O5 — CID 7880332
[2-(cyclohexylamino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate (PubChem CID 7880332) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7880332 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(furan-2-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccco1)NC1CCCCC1 |
| InChI | InChI=1S/C15H20N2O5/c18-13(17-11-5-2-1-3-6-11)10-22-14(19)9-16-15(20)12-7-4-8-21-12/h4,7-8,11H,1-3,5-6,9-10H2,(H,16,20)(H,17,18) |
| InChIKey | STGPBSPRWLZQCF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |