C17H24N2O3 — CID 124785873
N-[2-[[(2R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 124785873) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[2-[[(2R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(2R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 124785873 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[2-[[(2R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)N[C@@H]1CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C17H24N2O3/c20-16(11-18-17(21)15-6-3-9-22-15)19-14-8-7-12-4-1-2-5-13(12)10-14/h3,6,9,12-14H,1-2,4-5,7-8,10-11H2,(H,18,21)(H,19,20)/t12-,13+,14-/m1/s1 |
| InChIKey | LSQZGIVMDBGTLO-HZSPNIEDSA-N |
| XLogP | 2.48 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |