C13H18N2O4 — CID 103280341
N-[2-[(3-hydroxycyclopentyl)methylamino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 103280341) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[2-[(3-hydroxycyclopentyl)methylamino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(3-hydroxycyclopentyl)methylamino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 103280341 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-[2-[(3-hydroxycyclopentyl)methylamino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)NCC1CCC(O)C1 |
| InChI | InChI=1S/C13H18N2O4/c16-10-4-3-9(6-10)7-14-12(17)8-15-13(18)11-2-1-5-19-11/h1-2,5,9-10,16H,3-4,6-8H2,(H,14,17)(H,15,18) |
| InChIKey | MEHLKIBRJWDWHO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |