C17H22N2O4 — CID 9364084
[2-(cyclopentylamino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate (PubChem CID 9364084) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9364084 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate |
| SMILES | Cc1cccc(C(=O)NCC(=O)OCC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-12-5-4-6-13(9-12)17(22)18-10-16(21)23-11-15(20)19-14-7-2-3-8-14/h4-6,9,14H,2-3,7-8,10-11H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | LAZHJINTXCFPTB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |