C23H29FN10O3 — CID 143573354
N-amino-4-[2-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]-N'-(4-methoxycyclohexa-2,4-dien-1-yl)piperazine-1-carboximidamide (PubChem CID 143573354) has the molecular formula C23H29FN10O3 and a molecular weight of 512.55 g/mol. Its IUPAC name is N-amino-4-[2-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]-N'-(4-methoxycyclohexa-2,4-dien-1-yl)piperazine-1-carboximidamide.
| Compound Name | N-amino-4-[2-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]-N'-(4-methoxycyclohexa-2,4-dien-1-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 143573354 |
| Molecular Formula | C23H29FN10O3 |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | N-amino-4-[2-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]-N'-(4-methoxycyclohexa-2,4-dien-1-yl)piperazine-1-carboximidamide |
| SMILES | COC1=CCC(/N=C(\NN)N2CCN(C(=O)C(=O)c3c[nH]c4c(N(N)/C=C\N)ncc(F)c34)CC2)C=C1 |
| InChI | InChI=1S/C23H29FN10O3/c1-37-15-4-2-14(3-5-15)30-23(31-26)33-10-8-32(9-11-33)22(36)20(35)16-12-28-19-18(16)17(24)13-29-21(19)34(27)7-6-25/h2,4-7,12-14,28H,3,8-11,25-27H2,1H3,(H,30,31)/b7-6- |
| InChIKey | DLUWLKMHIRQYJP-SREVYHEPSA-N |
| XLogP | -0.18 |
| TPSA | 184.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|