C28H34FN9O2 — CID 71199151
1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[N-[3-(dimethylamino)propyl]-C-phenylcarbonimidoyl]piperazin-1-yl]ethane-1,2-dione (PubChem CID 71199151) has the molecular formula C28H34FN9O2 and a molecular weight of 547.64 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[N-[3-(dimethylamino)propyl]-C-phenylcarbonimidoyl]piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[N-[3-(dimethylamino)propyl]-C-phenylcarbonimidoyl]piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 71199151 |
| Molecular Formula | C28H34FN9O2 |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[N-[3-(dimethylamino)propyl]-C-phenylcarbonimidoyl]piperazin-1-yl]ethane-1,2-dione |
| SMILES | C=N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCN(/C(=N/CCCN(C)C)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C28H34FN9O2/c1-31-11-13-38(30)27-24-23(22(29)19-34-27)21(18-33-24)25(39)28(40)37-16-14-36(15-17-37)26(20-8-5-4-6-9-20)32-10-7-12-35(2)3/h4-6,8-9,11,13,18-19,33H,1,7,10,12,14-17,30H2,2-3H3/b13-11-,32-26+ |
| InChIKey | PURRQNKFLXNSFX-PGMIKISISA-N |
| XLogP | 2.28 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|