C26H29FN8O2 — CID 71199109
1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(C-phenyl-N-propan-2-ylcarbonimidoyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 71199109) has the molecular formula C26H29FN8O2 and a molecular weight of 504.57 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(C-phenyl-N-propan-2-ylcarbonimidoyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(C-phenyl-N-propan-2-ylcarbonimidoyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 71199109 |
| Molecular Formula | C26H29FN8O2 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(C-phenyl-N-propan-2-ylcarbonimidoyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | C=N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCN(/C(=N/C(C)C)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C26H29FN8O2/c1-17(2)32-24(18-7-5-4-6-8-18)33-11-13-34(14-12-33)26(37)23(36)19-15-30-22-21(19)20(27)16-31-25(22)35(28)10-9-29-3/h4-10,15-17,30H,3,11-14,28H2,1-2H3/b10-9-,32-24+ |
| InChIKey | FKJHFBHEYPSDOA-XWNPTOODSA-N |
| XLogP | 2.74 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|