C25H24FN9O2 — CID 143573435
1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(4-phenylpyrimidin-5-yl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 143573435) has the molecular formula C25H24FN9O2 and a molecular weight of 501.53 g/mol. Its IUPAC name is 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(4-phenylpyrimidin-5-yl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(4-phenylpyrimidin-5-yl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 143573435 |
| Molecular Formula | C25H24FN9O2 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 1-[7-[amino-[(Z)-2-aminoethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-(4-phenylpyrimidin-5-yl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCN(c4cncnc4-c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C25H24FN9O2/c26-18-13-31-24(35(28)7-6-27)22-20(18)17(12-30-22)23(36)25(37)34-10-8-33(9-11-34)19-14-29-15-32-21(19)16-4-2-1-3-5-16/h1-7,12-15,30H,8-11,27-28H2/b7-6- |
| InChIKey | SAASYRSGIWHURJ-SREVYHEPSA-N |
| XLogP | 1.80 |
| TPSA | 150.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|