C24H21Cl2N3O4 — CID 59007142
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[2,6-dichloro-4-(3-methyl-1,2-oxazol-5-yl)phenyl]ethane-1,2-dione (PubChem CID 59007142) has the molecular formula C24H21Cl2N3O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[2,6-dichloro-4-(3-methyl-1,2-oxazol-5-yl)phenyl]ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[2,6-dichloro-4-(3-methyl-1,2-oxazol-5-yl)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 59007142 |
| Molecular Formula | C24H21Cl2N3O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[2,6-dichloro-4-(3-methyl-1,2-oxazol-5-yl)phenyl]ethane-1,2-dione |
| SMILES | Cc1cc(-c2cc(Cl)c(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)C[C@H]3C)c(Cl)c2)on1 |
| InChI | InChI=1S/C24H21Cl2N3O4/c1-14-10-20(33-27-14)17-11-18(25)21(19(26)12-17)22(30)24(32)29-9-8-28(13-15(29)2)23(31)16-6-4-3-5-7-16/h3-7,10-12,15H,8-9,13H2,1-2H3/t15-/m1/s1 |
| InChIKey | LOWHMSFBPLMVBS-OAHLLOKOSA-N |
| XLogP | 4.51 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|